CAS 866-16-0
:Chlorotrifluorosuccinic acid
Description:
Chlorotrifluorosuccinic acid, with the CAS number 866-16-0, is a fluorinated organic compound characterized by the presence of both chlorine and fluorine atoms in its molecular structure. This compound features a succinic acid backbone, which is a dicarboxylic acid, modified by the substitution of three fluorine atoms and one chlorine atom. The presence of these halogens significantly influences its chemical properties, including increased reactivity and potential applications in various fields such as pharmaceuticals, agrochemicals, and materials science. Chlorotrifluorosuccinic acid is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It is known for its strong acidity and can participate in various chemical reactions, including nucleophilic substitutions and esterifications. Due to its fluorinated nature, it may exhibit unique characteristics such as enhanced thermal stability and resistance to degradation. Safety precautions are essential when handling this compound, as it may pose health risks and environmental concerns. Proper storage and disposal methods should be followed to mitigate any potential hazards.
Formula:C4H2ClF3O4
InChI:InChI=1/C4H2ClF3O4/c5-3(6,1(9)10)4(7,8)2(11)12/h(H,9,10)(H,11,12)
SMILES:C(=O)(C(C(C(=O)O)(F)F)(Cl)F)O
Synonyms:- 2-Chloro-2,3,3-Trifluorobutanedioic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.