
CAS 866009-83-8
:5-(2-Thienyl)-2-thioxo-1,3,4-oxadiazole-3(2H)-propanenitrile
Description:
5-(2-Thienyl)-2-thioxo-1,3,4-oxadiazole-3(2H)-propanenitrile, identified by its CAS number 866009-83-8, is a heterocyclic compound featuring a thienyl group and an oxadiazole ring. This compound is characterized by its unique structural framework, which includes a thioxo group and a nitrile functional group, contributing to its potential reactivity and biological activity. The presence of the thienyl moiety may impart specific electronic properties, enhancing its interactions in various chemical environments. Typically, compounds of this nature exhibit interesting pharmacological properties, making them subjects of interest in medicinal chemistry. Additionally, the oxadiazole ring is known for its stability and ability to participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. The compound's solubility, melting point, and other physical properties would depend on its specific molecular interactions and the presence of functional groups. Overall, this compound represents a class of organic molecules with potential applications in pharmaceuticals and materials science.
Formula:C9H7N3OS2
InChI:InChI=1S/C9H7N3OS2/c10-4-2-5-12-9(14)13-8(11-12)7-3-1-6-15-7/h1,3,6H,2,5H2
InChI key:InChIKey=ZNNLRWNWDYIAFN-UHFFFAOYSA-N
SMILES:C(CC#N)N1N=C(OC1=S)C2=CC=CS2
Synonyms:- 5-(2-Thienyl)-2-thioxo-1,3,4-oxadiazole-3(2H)-propanenitrile
- 1,3,4-Oxadiazole-3(2H)-propanenitrile, 5-(2-thienyl)-2-thioxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.