
CAS 866009-84-9
:2-Oxo-5-(2-thienyl)-1,3,4-oxadiazole-3(2H)-propanenitrile
Description:
2-Oxo-5-(2-thienyl)-1,3,4-oxadiazole-3(2H)-propanenitrile, with the CAS number 866009-84-9, is a heterocyclic compound characterized by the presence of an oxadiazole ring, which is a five-membered ring containing two nitrogen atoms and three carbon atoms. This compound features a thienyl group, which is derived from thiophene, contributing to its aromatic properties and potential electronic characteristics. The presence of a cyano group (-C≡N) enhances its reactivity and may impart useful properties for applications in organic synthesis or materials science. The oxadiazole moiety is known for its biological activity, making this compound of interest in medicinal chemistry. Additionally, the compound's structure suggests potential for interactions with biological targets, which could be explored for pharmacological applications. Its unique combination of functional groups may also influence solubility, stability, and reactivity, making it a candidate for further research in various chemical and pharmaceutical contexts.
Formula:C9H7N3O2S
InChI:InChI=1S/C9H7N3O2S/c10-4-2-5-12-9(13)14-8(11-12)7-3-1-6-15-7/h1,3,6H,2,5H2
InChI key:InChIKey=ULJYCMJLRCCNQG-UHFFFAOYSA-N
SMILES:C(CC#N)N1N=C(OC1=O)C2=CC=CS2
Synonyms:- 1,3,4-Oxadiazole-3(2H)-propanenitrile, 2-oxo-5-(2-thienyl)-
- 2-Oxo-5-(2-thienyl)-1,3,4-oxadiazole-3(2H)-propanenitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.