CymitQuimica logo

CAS 866011-02-1

:

N-[5-[[(2-Methylphenyl)methyl]thio]-1H-1,2,4-triazol-3-yl]benzenesulfonamide

Description:
N-[5-[[(2-Methylphenyl)methyl]thio]-1H-1,2,4-triazol-3-yl]benzenesulfonamide is a chemical compound characterized by its complex structure, which includes a triazole ring, a sulfonamide group, and a thioether linkage. The presence of the triazole moiety suggests potential applications in pharmaceuticals, particularly as antifungal agents, due to its ability to interact with biological targets. The sulfonamide group contributes to its solubility and reactivity, making it suitable for various chemical reactions. Additionally, the 2-methylphenyl group enhances its lipophilicity, potentially improving its bioavailability. This compound may exhibit specific biological activities, which can be attributed to its unique structural features. Its synthesis typically involves multi-step organic reactions, and it may be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its identity and purity. Overall, this compound represents a class of sulfonamide derivatives that may have significant implications in medicinal chemistry and drug development.
Formula:C16H16N4O2S2
InChI:InChI=1S/C16H16N4O2S2/c1-12-7-5-6-8-13(12)11-23-16-17-15(18-19-16)20-24(21,22)14-9-3-2-4-10-14/h2-10H,11H2,1H3,(H2,17,18,19,20)
InChI key:InChIKey=SQEQUMCFJAHDQY-UHFFFAOYSA-N
SMILES:N(S(=O)(=O)C1=CC=CC=C1)C=2NC(SCC3=C(C)C=CC=C3)=NN2
Synonyms:
  • Benzenesulfonamide, N-[5-[[(2-methylphenyl)methyl]thio]-1H-1,2,4-triazol-3-yl]-
  • N-[5-[[(2-Methylphenyl)methyl]thio]-1H-1,2,4-triazol-3-yl]benzenesulfonamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.