
CAS 866018-27-1
:4-Bromo-5-(4-methylphenoxy)-2-phenyl-3(2H)-pyridazinone
Description:
4-Bromo-5-(4-methylphenoxy)-2-phenyl-3(2H)-pyridazinone is a chemical compound characterized by its complex structure, which includes a pyridazinone core substituted with a bromine atom and a 4-methylphenoxy group. This compound typically exhibits properties such as moderate solubility in organic solvents, which is common for many pyridazinone derivatives. The presence of the bromine atom may impart unique reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. The phenyl and methylphenoxy substituents can influence the compound's biological activity, potentially enhancing its lipophilicity and affecting its interaction with biological targets. Additionally, compounds of this type may exhibit pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests potential applications in drug development, particularly in areas targeting specific biological pathways. As with many organic compounds, safety and handling precautions should be observed due to the presence of halogenated groups.
Formula:C17H13BrN2O2
InChI:InChI=1S/C17H13BrN2O2/c1-12-7-9-14(10-8-12)22-15-11-19-20(17(21)16(15)18)13-5-3-2-4-6-13/h2-11H,1H3
InChI key:InChIKey=USJXMCSUZLYPBD-UHFFFAOYSA-N
SMILES:O=C1N(N=CC(OC2=CC=C(C)C=C2)=C1Br)C3=CC=CC=C3
Synonyms:- 3(2H)-Pyridazinone, 4-bromo-5-(4-methylphenoxy)-2-phenyl-
- 4-Bromo-5-(4-methylphenoxy)-2-phenyl-3(2H)-pyridazinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.