
CAS 866018-47-5
:2,3-Dihydro-8-phenoxy-4-(2-phenylethenyl)thieno[3,2-c]quinoline
Description:
2,3-Dihydro-8-phenoxy-4-(2-phenylethenyl)thieno[3,2-c]quinoline is a complex organic compound characterized by its unique structural features, which include a thienoquinoline core and phenoxy and phenylethenyl substituents. This compound typically exhibits a range of chemical properties, including moderate solubility in organic solvents and potential reactivity due to the presence of multiple functional groups. The thienoquinoline framework suggests potential biological activity, as many compounds in this class are investigated for their pharmacological properties. The phenoxy group may enhance lipophilicity, influencing the compound's interaction with biological membranes. Additionally, the presence of the phenylethenyl moiety could contribute to its electronic properties, possibly affecting its optical characteristics. Overall, this compound's structural complexity and functional groups suggest it may have applications in medicinal chemistry, particularly in the development of novel therapeutic agents. However, specific data regarding its biological activity, stability, and synthesis would require further investigation and experimental validation.
Formula:C25H19NOS
InChI:InChI=1S/C25H19NOS/c1-3-7-18(8-4-1)11-13-23-21-15-16-28-25(21)22-17-20(12-14-24(22)26-23)27-19-9-5-2-6-10-19/h1-14,17H,15-16H2
InChI key:InChIKey=FPHKEQMADXPAAB-UHFFFAOYSA-N
SMILES:O(C=1C=C2C3=C(C(C=CC4=CC=CC=C4)=NC2=CC1)CCS3)C5=CC=CC=C5
Synonyms:- 2,3-Dihydro-8-phenoxy-4-(2-phenylethenyl)thieno[3,2-c]quinoline
- Thieno[3,2-c]quinoline, 2,3-dihydro-8-phenoxy-4-(2-phenylethenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.