CAS 866018-60-2

2-Methyl-5-[5-(4-morpholinyl)-2-nitrophenyl]pyrazolo[1,5-a]pyrimidine

Description:

2-Methyl-5-[5-(4-morpholinyl)-2-nitrophenyl]pyrazolo[1,5-a]pyrimidine is a synthetic organic compound characterized by its complex structure, which includes a pyrazolo-pyrimidine core. This compound features a methyl group and a nitrophenyl moiety, along with a morpholine ring, contributing to its potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific formulation and purity. The presence of the nitro group suggests potential reactivity and the ability to participate in electrophilic substitution reactions. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features that could interact with biological targets. Its specific properties, such as melting point, boiling point, and spectral data, would need to be determined experimentally or sourced from reliable chemical databases. Safety data should also be consulted, as compounds with nitro groups can pose health risks and require careful handling.

Formula: C₁₇H₁₇N₅O₃

InChI: InChI=1S/C17H17N5O3/c1-12-10-17-18-15(4-5-21(17)19-12)14-11-13(2-3-16(14)22(23)24)20-6-8-25-9-7-20/h2-5,10-11H,6-9H2,1H3

InChI key: InChIKey=ZMUXHDBEHINODQ-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(C=C(C=C1)N2CCOCC2)C3=NC=4N(C=C3)N=C(C)C4

Synonyms:

• 2-Methyl-5-[5-(4-morpholinyl)-2-nitrophenyl]pyrazolo[1,5-a]pyrimidine
• Pyrazolo[1,5-a]pyrimidine, 2-methyl-5-[5-(4-morpholinyl)-2-nitrophenyl]-