CymitQuimica logo

CAS 866019-05-8

:

5-Bromo-4,6-dimethyl-2-(4-morpholinyl)-3-pyridinecarbonitrile

Description:
5-Bromo-4,6-dimethyl-2-(4-morpholinyl)-3-pyridinecarbonitrile is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a bromine atom, two methyl groups, and a morpholine moiety. This compound is typically classified as a heterocyclic organic compound due to the presence of nitrogen in the pyridine and morpholine rings. It exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the cyano group (carbonitrile) contributes to its reactivity, allowing for various chemical transformations. Additionally, the bromine substituent can enhance the compound's lipophilicity and influence its interaction with biological targets. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. As with many organic compounds, safety and handling precautions should be observed, as it may pose health risks if not managed properly.
Formula:C12H14BrN3O
InChI:InChI=1S/C12H14BrN3O/c1-8-10(7-14)12(15-9(2)11(8)13)16-3-5-17-6-4-16/h3-6H2,1-2H3
InChI key:InChIKey=XNXZOAONJITEFN-UHFFFAOYSA-N
SMILES:C(#N)C1=C(N=C(C)C(Br)=C1C)N2CCOCC2
Synonyms:
  • 3-Pyridinecarbonitrile, 5-bromo-4,6-dimethyl-2-(4-morpholinyl)-
  • 5-Bromo-4,6-dimethyl-2-(4-morpholinyl)-3-pyridinecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.