CAS 866019-22-9

5-Bromo-4,6-dimethyl-2-(2-pyrimidinylthio)-3-pyridinecarbonitrile

Description:

5-Bromo-4,6-dimethyl-2-(2-pyrimidinylthio)-3-pyridinecarbonitrile is a chemical compound characterized by its complex structure, which includes a bromine atom, multiple methyl groups, and a pyrimidinylthio moiety. This compound features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom, contributing to its potential biological activity. The presence of the cyano group (carbonitrile) enhances its reactivity and may influence its solubility and interaction with biological targets. The bromine substituent can also play a significant role in the compound's reactivity and stability. This compound is likely to exhibit properties typical of heterocyclic compounds, such as potential antimicrobial or anticancer activities, making it of interest in medicinal chemistry. Its synthesis and characterization would typically involve standard organic chemistry techniques, and it may be utilized in various applications, including drug development and research into new therapeutic agents. As with many such compounds, safety and handling precautions are essential due to potential toxicity and reactivity.

Formula: C₁₂H₉BrN₄S

InChI: InChI=1S/C12H9BrN4S/c1-7-9(6-14)11(17-8(2)10(7)13)18-12-15-4-3-5-16-12/h3-5H,1-2H3

InChI key: InChIKey=RQEFAGSDZYITFD-UHFFFAOYSA-N

SMILES: S(C1=C(C#N)C(C)=C(Br)C(C)=N1)C=2N=CC=CN2

Synonyms:

• 5-Bromo-4,6-dimethyl-2-(2-pyrimidinylthio)-3-pyridinecarbonitrile
• 3-Pyridinecarbonitrile, 5-bromo-4,6-dimethyl-2-(2-pyrimidinylthio)-