
CAS 866019-34-3
:β-Cyclohexyl-1H-pyrrole-1-propanoic acid
Description:
β-Cyclohexyl-1H-pyrrole-1-propanoic acid, identified by its CAS number 866019-34-3, is an organic compound characterized by its unique structure that combines a cyclohexyl group with a pyrrole ring and a propanoic acid moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the pyrrole ring suggests that it may participate in various chemical reactions, including electrophilic substitutions and coordination with metal ions. Additionally, the cyclohexyl group can influence the compound's hydrophobicity and steric properties, which may affect its solubility and interaction with biological targets. As a propanoic acid derivative, it possesses acidic characteristics, allowing it to participate in acid-base reactions. The compound's specific applications and biological activities would depend on its interactions at the molecular level, making it of interest in medicinal chemistry and drug development. Further studies would be necessary to fully elucidate its properties and potential uses in various fields.
Formula:C13H19NO2
InChI:InChI=1S/C13H19NO2/c15-13(16)10-12(14-8-4-5-9-14)11-6-2-1-3-7-11/h4-5,8-9,11-12H,1-3,6-7,10H2,(H,15,16)
InChI key:InChIKey=MIDDKVUHRANSGU-UHFFFAOYSA-N
SMILES:C(CC(O)=O)(C1CCCCC1)N2C=CC=C2
Synonyms:- 1H-Pyrrole-1-propanoic acid, β-cyclohexyl-
- β-Cyclohexyl-1H-pyrrole-1-propanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.