
CAS 866019-35-4
:β-(4-Nitrophenyl)-1H-pyrrole-1-propanoic acid
Description:
β-(4-Nitrophenyl)-1H-pyrrole-1-propanoic acid is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. The presence of a nitrophenyl group at the β-position introduces significant electron-withdrawing characteristics, influencing the compound's reactivity and solubility. This compound typically exhibits acidic properties due to the carboxylic acid functional group (-COOH) present in its structure, which can donate protons in solution. The nitro group (-NO2) is known for its strong electron-withdrawing effects, which can enhance the electrophilicity of the pyrrole ring, making it more reactive towards nucleophiles. Additionally, the compound may display interesting biological activities, making it a subject of interest in medicinal chemistry. Its solubility and stability can vary depending on the solvent and pH conditions, which are important factors to consider in experimental applications. Overall, β-(4-Nitrophenyl)-1H-pyrrole-1-propanoic acid is a versatile compound with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C13H12N2O4
InChI:InChI=1S/C13H12N2O4/c16-13(17)9-12(14-7-1-2-8-14)10-3-5-11(6-4-10)15(18)19/h1-8,12H,9H2,(H,16,17)
InChI key:InChIKey=HLNWXAGAISCNHC-UHFFFAOYSA-N
SMILES:C(CC(O)=O)(C1=CC=C(N(=O)=O)C=C1)N2C=CC=C2
Synonyms:- β-(4-Nitrophenyl)-1H-pyrrole-1-propanoic acid
- 1H-Pyrrole-1-propanoic acid, β-(4-nitrophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.