CAS 866019-62-7
:2,4-Dichlorobenzoic acid 2-[[(3,4-dimethoxyphenyl)amino]carbonyl]hydrazide
Description:
2,4-Dichlorobenzoic acid 2-[[(3,4-dimethoxyphenyl)amino]carbonyl]hydrazide is a chemical compound characterized by its complex structure, which includes a dichlorobenzoic acid moiety and a hydrazide functional group. This compound typically exhibits properties associated with both hydrazides and aromatic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The dichlorobenzoic acid component contributes to its acidity and potential for forming salts, while the dimethoxyphenyl group may enhance its lipophilicity and biological activity. The compound may also exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. As with many organic compounds, safety and handling precautions should be observed, as the presence of chlorine atoms may indicate toxicity or environmental concerns. Overall, this compound represents a unique combination of functional groups that may lend itself to various chemical and biological investigations.
Formula:C16H15Cl2N3O4
InChI:InChI=1S/C16H15Cl2N3O4/c1-24-13-6-4-10(8-14(13)25-2)19-16(23)21-20-15(22)11-5-3-9(17)7-12(11)18/h3-8H,1-2H3,(H,20,22)(H2,19,21,23)
InChI key:InChIKey=NQYYJNCWFYPUNU-UHFFFAOYSA-N
SMILES:N(C(NNC(=O)C1=C(Cl)C=C(Cl)C=C1)=O)C2=CC(OC)=C(OC)C=C2
Synonyms:- 2,4-Dichlorobenzoic acid 2-[[(3,4-dimethoxyphenyl)amino]carbonyl]hydrazide
- Benzoic acid, 2,4-dichloro-, 2-[[(3,4-dimethoxyphenyl)amino]carbonyl]hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.