
CAS 866019-78-5
:4-[2-(1,3-Dihydro-1,3-dioxo-2H-isoindol-2-yl)ethyl]-α-[[4-(methylthio)phenyl]methylene]-2-thiazoleacetonitrile
Description:
The chemical substance known as 4-[2-(1,3-Dihydro-1,3-dioxo-2H-isoindol-2-yl)ethyl]-α-[[4-(methylthio)phenyl]methylene]-2-thiazoleacetonitrile, with the CAS number 866019-78-5, is a synthetic organic compound characterized by its complex molecular structure. It features multiple functional groups, including a thiazole ring, a nitrile group, and an isoindole moiety, which contribute to its potential biological activity. The presence of the methylthio group suggests possible interactions with biological systems, potentially influencing its pharmacological properties. This compound may exhibit properties such as anti-inflammatory, anticancer, or antimicrobial activities, although specific biological effects would require empirical investigation. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other substances. As with many synthetic compounds, safety data, including toxicity and handling precautions, should be reviewed before use in any application. Overall, this compound represents a class of molecules that may have significant implications in medicinal chemistry and drug development.
Formula:C23H17N3O2S2
InChI:InChI=1S/C23H17N3O2S2/c1-29-18-8-6-15(7-9-18)12-16(13-24)21-25-17(14-30-21)10-11-26-22(27)19-4-2-3-5-20(19)23(26)28/h2-9,12,14H,10-11H2,1H3
InChI key:InChIKey=ZDAKAUMIGQBHTR-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)N1CCC=3N=C(C(=CC4=CC=C(SC)C=C4)C#N)SC3)=CC=CC2
Synonyms:- 4-[2-(1,3-Dihydro-1,3-dioxo-2H-isoindol-2-yl)ethyl]-α-[[4-(methylthio)phenyl]methylene]-2-thiazoleacetonitrile
- 2-Thiazoleacetonitrile, 4-[2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)ethyl]-α-[[4-(methylthio)phenyl]methylene]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.