CAS 866019-85-4

α-[[2-(2,4-Dichlorophenoxy)phenyl]methylene]-3-methoxybenzeneacetonitrile

Description:

α-[[2-(2,4-Dichlorophenoxy)phenyl]methylene]-3-methoxybenzeneacetonitrile, identified by its CAS number 866019-85-4, is a synthetic organic compound characterized by its complex structure, which includes multiple aromatic rings and functional groups. This compound features a methylene bridge connecting a dichlorophenoxyphenyl moiety to a methoxy-substituted benzeneacetonitrile group. The presence of the dichlorophenoxy group suggests potential applications in herbicidal activity, as similar compounds are often utilized in agricultural chemistry. The methoxy group may influence the compound's solubility and reactivity, while the acetonitrile functional group can impart specific chemical properties, such as polarity and potential for nucleophilic reactions. Overall, this compound's unique structure may contribute to its biological activity and utility in various chemical applications, although specific data on its physical properties, such as melting point, boiling point, and solubility, would require further investigation or empirical measurement.

Formula: C₂₂H₁₅Cl₂NO₂

InChI: InChI=1S/C22H15Cl2NO2/c1-26-19-7-4-6-15(12-19)17(14-25)11-16-5-2-3-8-21(16)27-22-10-9-18(23)13-20(22)24/h2-13H,1H3

InChI key: InChIKey=UVQFFXGQJQEQDI-UHFFFAOYSA-N

SMILES: C(=C(C#N)C1=CC(OC)=CC=C1)C2=C(OC3=C(Cl)C=C(Cl)C=C3)C=CC=C2

Synonyms:

• Benzeneacetonitrile, α-[[2-(2,4-dichlorophenoxy)phenyl]methylene]-3-methoxy-
• α-[[2-(2,4-Dichlorophenoxy)phenyl]methylene]-3-methoxybenzeneacetonitrile