
CAS 866019-86-5
:4-[2-(1,3-Dihydro-1,3-dioxo-2H-isoindol-2-yl)ethyl]-α-[[1,2,3,4-tetrahydro-1-(2-methylpropyl)-6-quinolinyl]methylene]-2-thiazoleacetonitrile
Description:
The chemical substance known as 4-[2-(1,3-Dihydro-1,3-dioxo-2H-isoindol-2-yl)ethyl]-α-[[1,2,3,4-tetrahydro-1-(2-methylpropyl)-6-quinolinyl]methylene]-2-thiazoleacetonitrile, with the CAS number 866019-86-5, is a complex organic compound characterized by its unique structural features. It contains multiple functional groups, including a thiazole ring, a quinoline moiety, and a dioxo-isoindole structure, which contribute to its potential biological activity. The presence of the thiazole and quinoline rings suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The compound's molecular structure indicates it may exhibit properties such as lipophilicity and the ability to form hydrogen bonds, which are crucial for its interaction with biological systems. Additionally, the presence of a nitrile group may enhance its reactivity and solubility characteristics. Overall, this compound's intricate structure and functional diversity position it as a candidate for further research in pharmacology and drug development.
Formula:C29H28N4O2S
InChI:InChI=1S/C29H28N4O2S/c1-19(2)17-32-12-5-6-21-14-20(9-10-26(21)32)15-22(16-30)27-31-23(18-36-27)11-13-33-28(34)24-7-3-4-8-25(24)29(33)35/h3-4,7-10,14-15,18-19H,5-6,11-13,17H2,1-2H3
InChI key:InChIKey=MWDMHTFDCHQUCO-UHFFFAOYSA-N
SMILES:C(C(C)C)N1C=2C(=CC(C=C(C#N)C3=NC(CCN4C(=O)C=5C(C4=O)=CC=CC5)=CS3)=CC2)CCC1
Synonyms:- 2-Thiazoleacetonitrile, 4-[2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)ethyl]-α-[[1,2,3,4-tetrahydro-1-(2-methylpropyl)-6-quinolinyl]methylene]-
- 4-[2-(1,3-Dihydro-1,3-dioxo-2H-isoindol-2-yl)ethyl]-α-[[1,2,3,4-tetrahydro-1-(2-methylpropyl)-6-quinolinyl]methylene]-2-thiazoleacetonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.