
CAS 866020-01-1
:α-(1-Naphthalenylmethylene)-4-(1H-pyrrol-1-yl)benzeneacetonitrile
Description:
α-(1-Naphthalenylmethylene)-4-(1H-pyrrol-1-yl)benzeneacetonitrile, with the CAS number 866020-01-1, is a synthetic organic compound characterized by its complex structure, which includes a naphthalene moiety, a pyrrole ring, and a nitrile functional group. This compound typically exhibits properties associated with aromatic systems, such as stability and potential for π-π stacking interactions. The presence of the nitrile group suggests it may participate in hydrogen bonding and exhibit polar characteristics, influencing its solubility in various solvents. Additionally, the compound's structure may confer interesting electronic properties, making it a candidate for applications in organic electronics or as a potential ligand in coordination chemistry. Its synthesis and reactivity can be influenced by the functional groups present, allowing for potential modifications to enhance its chemical properties or biological activity. Overall, this compound represents a unique combination of structural features that may be explored for various chemical applications.
Formula:C23H16N2
InChI:InChI=1S/C23H16N2/c24-17-21(16-20-8-5-7-19-6-1-2-9-23(19)20)18-10-12-22(13-11-18)25-14-3-4-15-25/h1-16H
InChI key:InChIKey=NKXFPNUGHWTIKP-UHFFFAOYSA-N
SMILES:C(=C(C#N)C1=CC=C(C=C1)N2C=CC=C2)C=3C4=C(C=CC3)C=CC=C4
Synonyms:- α-(1-Naphthalenylmethylene)-4-(1H-pyrrol-1-yl)benzeneacetonitrile
- Benzeneacetonitrile, α-(1-naphthalenylmethylene)-4-(1H-pyrrol-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.