
CAS 866020-56-6
:1-[2-(6-Chloro-3-pyridinyl)ethyl]-2,3,4,9-tetrahydro-6-methoxy-1-methyl-1H-pyrido[3,4-b]indole
Description:
1-[2-(6-Chloro-3-pyridinyl)ethyl]-2,3,4,9-tetrahydro-6-methoxy-1-methyl-1H-pyrido[3,4-b]indole, with CAS number 866020-56-6, is a chemical compound characterized by its complex structure, which includes a pyridoindole framework. This compound features a chloro-substituted pyridine moiety and a methoxy group, contributing to its potential biological activity. The tetrahydro structure indicates that it contains a saturated ring system, which may influence its pharmacokinetic properties. The presence of the chloro group can enhance lipophilicity, potentially affecting the compound's interaction with biological targets. This substance is of interest in medicinal chemistry, particularly for its potential applications in treating neurological disorders or as a pharmacological agent. Its specific interactions and mechanisms of action would require further investigation through experimental studies. Overall, the unique structural features of this compound suggest it may exhibit interesting biological properties, warranting further research into its therapeutic potential.
Formula:C20H22ClN3O
InChI:InChI=1S/C20H22ClN3O/c1-20(9-7-13-3-6-18(21)22-12-13)19-15(8-10-23-20)16-11-14(25-2)4-5-17(16)24-19/h3-6,11-12,23-24H,7-10H2,1-2H3
InChI key:InChIKey=VZBOJJWNLWHOCP-UHFFFAOYSA-N
SMILES:C(CC=1C=CC(Cl)=NC1)C2(C)C3=C(C=4C(N3)=CC=C(OC)C4)CCN2
Synonyms:- 1-[2-(6-Chloro-3-pyridinyl)ethyl]-2,3,4,9-tetrahydro-6-methoxy-1-methyl-1H-pyrido[3,4-b]indole
- 1H-Pyrido[3,4-b]indole, 1-[2-(6-chloro-3-pyridinyl)ethyl]-2,3,4,9-tetrahydro-6-methoxy-1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.