CAS 866020-60-2

4-[4-(Phenylmethyl)-1-piperidinyl]thieno[2,3-d]pyrimidine-6-carboxylic acid hydrazide

Description:

4-[4-(Phenylmethyl)-1-piperidinyl]thieno[2,3-d]pyrimidine-6-carboxylic acid hydrazide, with CAS number 866020-60-2, is a synthetic organic compound characterized by its complex structure, which includes a thieno[2,3-d]pyrimidine core, a carboxylic acid functional group, and a hydrazide moiety. This compound exhibits potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its structure suggests the presence of multiple functional groups that may contribute to its reactivity and interaction with biological targets. The phenylmethyl and piperidine substituents may enhance its lipophilicity and ability to cross biological membranes, which is crucial for drug efficacy. Additionally, the thieno and pyrimidine rings may provide specific interactions with enzymes or receptors, influencing its pharmacological profile. As with many compounds in drug development, understanding its solubility, stability, and metabolic pathways is essential for assessing its therapeutic potential and safety.

Formula: C₁₉H₂₁N₅OS

InChI: InChI=1S/C19H21N5OS/c20-23-18(25)16-11-15-17(21-12-22-19(15)26-16)24-8-6-14(7-9-24)10-13-4-2-1-3-5-13/h1-5,11-12,14H,6-10,20H2,(H,23,25)

InChI key: InChIKey=JPNPFHNYFAIFNH-UHFFFAOYSA-N

SMILES: C(NN)(=O)C1=CC2=C(N=CN=C2S1)N3CCC(CC4=CC=CC=C4)CC3

Synonyms:

• 4-[4-(Phenylmethyl)-1-piperidinyl]thieno[2,3-d]pyrimidine-6-carboxylic acid hydrazide
• Thieno[2,3-d]pyrimidine-6-carboxylic acid, 4-[4-(phenylmethyl)-1-piperidinyl]-, hydrazide