
CAS 866023-58-7
:N-(3-Amino-4-fluorophenyl)benzamide
Description:
N-(3-Amino-4-fluorophenyl)benzamide, identified by its CAS number 866023-58-7, is an organic compound characterized by the presence of an amide functional group attached to a benzene ring. This compound features a fluorine atom and an amino group on the aromatic ring, which can influence its chemical reactivity and biological activity. The presence of the amino group suggests potential for hydrogen bonding, while the fluorine atom may enhance lipophilicity and metabolic stability. This compound is likely to exhibit moderate solubility in polar solvents due to the amide functionality, while the aromatic rings contribute to its hydrophobic characteristics. N-(3-Amino-4-fluorophenyl)benzamide may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential interactions with biological targets. Its structural features could allow for specific binding interactions, making it a candidate for further investigation in drug design and development. As with many organic compounds, safety and handling precautions should be observed when working with this substance in a laboratory setting.
Formula:C13H11FN2O
InChI:InChI=1S/C13H11FN2O/c14-11-7-6-10(8-12(11)15)16-13(17)9-4-2-1-3-5-9/h1-8H,15H2,(H,16,17)
InChI key:InChIKey=PXDSPSVHSIFKEQ-UHFFFAOYSA-N
SMILES:N(C(=O)C1=CC=CC=C1)C2=CC(N)=C(F)C=C2
Synonyms:- Benzamide, N-(3-amino-4-fluorophenyl)-
- N-(3-Amino-4-fluorophenyl)benzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.