CAS 866030-33-3
:(2S,5R)-3,6-Diethoxy-2,5-dihydro-2-[(2S)-2-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-3-methylbutyl]-5-(1-methylethyl)pyrazine
Description:
The chemical substance with the name "(2S,5R)-3,6-Diethoxy-2,5-dihydro-2-[(2S)-2-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-3-methylbutyl]-5-(1-methylethyl)pyrazine" and CAS number "866030-33-3" is a complex organic compound characterized by its multi-functional groups and stereochemistry. It features a pyrazine core, which contributes to its potential biological activity, and includes multiple ethoxy and methoxy substituents that enhance its solubility and reactivity. The presence of chiral centers indicates that the compound can exist in different stereoisomeric forms, which may influence its pharmacological properties. This compound is likely to exhibit specific interactions with biological targets, making it of interest in medicinal chemistry and drug development. Its structural complexity suggests potential applications in various fields, including pharmaceuticals and agrochemicals, although detailed studies would be necessary to fully understand its properties and potential uses.
Formula:C28H46N2O5
InChI:InChI=1/C28H46N2O5/c1-9-33-27-23(29-28(34-10-2)26(30-27)20(5)6)18-22(19(3)4)16-21-12-13-24(32-8)25(17-21)35-15-11-14-31-7/h12-13,17,19-20,22-23,26H,9-11,14-16,18H2,1-8H3/t22-,23-,26+/m0/s1
Synonyms:- Aliskiren inter-9
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.