
CAS 866038-50-8
:5-Methoxy-N-2-pyrimidinyl-1H-indole-3-ethanamine
Description:
5-Methoxy-N-2-pyrimidinyl-1H-indole-3-ethanamine, with the CAS number 866038-50-8, is a chemical compound that belongs to the class of indole derivatives. This substance features a methoxy group and a pyrimidinyl moiety, which contribute to its unique chemical properties and potential biological activities. The indole structure is known for its presence in various natural products and pharmaceuticals, often exhibiting significant pharmacological effects. The presence of the ethylamine side chain may enhance its interaction with biological targets, potentially influencing its activity as a neurotransmitter or receptor modulator. The compound's solubility, stability, and reactivity can vary based on its functional groups and the surrounding environment. While specific biological activities and applications may require further investigation, compounds of this nature are often explored in medicinal chemistry for their potential therapeutic uses, particularly in neuropharmacology. As with any chemical substance, safety and handling precautions should be observed, and its use should comply with relevant regulations.
Formula:C15H16N4O
InChI:InChI=1S/C15H16N4O/c1-20-12-3-4-14-13(9-12)11(10-19-14)5-8-18-15-16-6-2-7-17-15/h2-4,6-7,9-10,19H,5,8H2,1H3,(H,16,17,18)
InChI key:InChIKey=FVYLGVNUMRRJOL-UHFFFAOYSA-N
SMILES:C(CNC=1N=CC=CN1)C=2C=3C(NC2)=CC=C(OC)C3
Synonyms:- 1H-Indole-3-ethanamine, 5-methoxy-N-2-pyrimidinyl-
- 5-Methoxy-N-2-pyrimidinyl-1H-indole-3-ethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.