
CAS 866039-19-2
:N-[4,6-Dimethyl-3-(1H-pyrrol-1-yl)thieno[2,3-b]pyridin-2-yl]-N′-phenylurea
Description:
N-[4,6-Dimethyl-3-(1H-pyrrol-1-yl)thieno[2,3-b]pyridin-2-yl]-N′-phenylurea, with the CAS number 866039-19-2, is a synthetic organic compound characterized by its complex structure, which includes a thieno[2,3-b]pyridine core, a pyrrole moiety, and a urea functional group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. Its molecular structure suggests it may interact with biological targets, possibly influencing various biochemical pathways. The presence of multiple functional groups, including methyl and phenyl substituents, can affect its reactivity and stability. Additionally, the compound may display specific pharmacological properties, which are often evaluated through in vitro and in vivo studies. Overall, this compound represents a class of molecules that may have applications in drug development, particularly in areas related to neuropharmacology or oncology, although detailed studies would be necessary to fully elucidate its characteristics and potential uses.
Formula:C20H18N4OS
InChI:InChI=1S/C20H18N4OS/c1-13-12-14(2)21-18-16(13)17(24-10-6-7-11-24)19(26-18)23-20(25)22-15-8-4-3-5-9-15/h3-12H,1-2H3,(H2,22,23,25)
InChI key:InChIKey=ZZUZEBILGCEGMQ-UHFFFAOYSA-N
SMILES:N(C(NC1=CC=CC=C1)=O)C2=C(C=3C(S2)=NC(C)=CC3C)N4C=CC=C4
Synonyms:- N-[4,6-Dimethyl-3-(1H-pyrrol-1-yl)thieno[2,3-b]pyridin-2-yl]-N′-phenylurea
- Urea, N-[4,6-dimethyl-3-(1H-pyrrol-1-yl)thieno[2,3-b]pyridin-2-yl]-N′-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.