CAS 866039-43-2

4-[[(2-Chloro-5-thiazolyl)methyl]thio]benzoic acid

Description:

4-[[(2-Chloro-5-thiazolyl)methyl]thio]benzoic acid, identified by its CAS number 866039-43-2, is a chemical compound characterized by its thiazole and benzoic acid moieties. This compound features a thiazole ring, which contributes to its biological activity, and a benzoic acid functional group that provides acidity and potential for hydrogen bonding. The presence of a chlorine atom on the thiazole ring enhances its reactivity and may influence its pharmacological properties. The thioether linkage between the thiazole and benzoic acid components suggests potential for interactions in biological systems, making it of interest in medicinal chemistry. This compound may exhibit various properties, including solubility in organic solvents and moderate stability under standard conditions. Its unique structure may allow for specific interactions with biological targets, making it a candidate for further research in drug development or as a biochemical probe. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₁H₈ClNO₂S₂

InChI: InChI=1S/C11H8ClNO2S2/c12-11-13-5-9(17-11)6-16-8-3-1-7(2-4-8)10(14)15/h1-5H,6H2,(H,14,15)

InChI key: InChIKey=GHMOISZEIKTQDE-UHFFFAOYSA-N

SMILES: S(CC=1SC(Cl)=NC1)C2=CC=C(C(O)=O)C=C2

Synonyms:

• 4-[[(2-Chloro-5-thiazolyl)methyl]thio]benzoic acid
• Benzoic acid, 4-[[(2-chloro-5-thiazolyl)methyl]thio]-