CymitQuimica logo

CAS 866039-52-3

:

2-[2-[(4-Nitrobenzoyl)oxy]ethyl]-2H-pyrido[3,2-b]-1,4-oxazin-3(4H)-one

Description:
2-[2-[(4-Nitrobenzoyl)oxy]ethyl]-2H-pyrido[3,2-b]-1,4-oxazin-3(4H)-one is a complex organic compound characterized by its unique structural features, which include a pyrido-oxazine core and a nitrobenzoyl moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to the presence of functional groups that can participate in various chemical reactions. The nitro group may contribute to its reactivity and potential applications in medicinal chemistry, while the oxazine ring can influence its stability and interaction with biological targets. The compound's molecular structure suggests it may be of interest in research areas such as drug development or as a chemical probe in biological studies. Its specific characteristics, including melting point, boiling point, and spectral data, would require empirical measurement or detailed literature references for precise values. Overall, this compound represents a class of heterocyclic compounds that may possess interesting pharmacological properties.
Formula:C16H13N3O6
InChI:InChI=1S/C16H13N3O6/c20-15-13(25-12-2-1-8-17-14(12)18-15)7-9-24-16(21)10-3-5-11(6-4-10)19(22)23/h1-6,8,13H,7,9H2,(H,17,18,20)
InChI key:InChIKey=KTTWQXALBQTKIN-UHFFFAOYSA-N
SMILES:C(COC(=O)C1=CC=C(N(=O)=O)C=C1)C2OC=3C(NC2=O)=NC=CC3
Synonyms:
  • 2H-Pyrido[3,2-b]-1,4-oxazin-3(4H)-one, 2-[2-[(4-nitrobenzoyl)oxy]ethyl]-
  • 2-[2-[(4-Nitrobenzoyl)oxy]ethyl]-2H-pyrido[3,2-b]-1,4-oxazin-3(4H)-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.