CAS 866039-53-4

2-(3,4-Dihydro-3-oxo-2H-pyrido[3,2-b]-1,4-oxazin-2-yl)ethyl 2-furancarboxylate

Description:

2-(3,4-Dihydro-3-oxo-2H-pyrido[3,2-b]-1,4-oxazin-2-yl)ethyl 2-furancarboxylate, with the CAS number 866039-53-4, is a chemical compound characterized by its complex structure, which includes a pyrido-oxazine moiety and a furan carboxylate group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, which may include antimicrobial or anticancer effects, although specific biological data would need to be referenced from empirical studies. The presence of both the pyridine and furan rings suggests that it may participate in various chemical reactions, including nucleophilic substitutions or cycloadditions. Additionally, the ester functional group in the structure may influence its solubility and reactivity in organic solvents. As with many organic compounds, its stability and reactivity can be affected by environmental conditions such as pH and temperature. Further characterization through techniques like NMR, IR spectroscopy, and mass spectrometry would provide more detailed insights into its properties and potential applications in medicinal chemistry or material science.

Formula: C₁₄H₁₂N₂O₅

InChI: InChI=1S/C14H12N2O5/c17-13-10(21-9-3-1-6-15-12(9)16-13)5-8-20-14(18)11-4-2-7-19-11/h1-4,6-7,10H,5,8H2,(H,15,16,17)

InChI key: InChIKey=JBZRRBVAQLMWAK-UHFFFAOYSA-N

SMILES: C(COC(=O)C1=CC=CO1)C2OC=3C(NC2=O)=NC=CC3

Synonyms:

• 2-(3,4-Dihydro-3-oxo-2H-pyrido[3,2-b]-1,4-oxazin-2-yl)ethyl 2-furancarboxylate
• 2-Furancarboxylic acid, 2-(3,4-dihydro-3-oxo-2H-pyrido[3,2-b]-1,4-oxazin-2-yl)ethyl ester