
CAS 866039-71-6
:N-(2-Cyano-4,5-dimethoxyphenyl)-4-morpholinecarbothioamide
Description:
N-(2-Cyano-4,5-dimethoxyphenyl)-4-morpholinecarbothioamide is a chemical compound characterized by its unique structural features, which include a cyano group, methoxy substituents, and a morpholine moiety. This compound typically exhibits properties associated with thioamide derivatives, such as potential biological activity and solubility in organic solvents. The presence of the cyano group may contribute to its reactivity and ability to participate in various chemical reactions, while the methoxy groups can influence its electronic properties and steric hindrance. Morpholine, a cyclic amine, adds to the compound's potential for forming hydrogen bonds, which can affect its interactions with biological targets. The compound's molecular structure suggests it may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential for modulating biological pathways. However, specific characteristics such as melting point, boiling point, and solubility would require empirical data for precise determination. As with any chemical, safety and handling precautions should be observed, given the potential hazards associated with its components.
Formula:C14H17N3O3S
InChI:InChI=1S/C14H17N3O3S/c1-18-12-7-10(9-15)11(8-13(12)19-2)16-14(21)17-3-5-20-6-4-17/h7-8H,3-6H2,1-2H3,(H,16,21)
InChI key:InChIKey=MZOCCOGYLYAQRM-UHFFFAOYSA-N
SMILES:N(C(=S)N1CCOCC1)C2=C(C#N)C=C(OC)C(OC)=C2
Synonyms:- N-(2-Cyano-4,5-dimethoxyphenyl)-4-morpholinecarbothioamide
- 4-Morpholinecarbothioamide, N-(2-cyano-4,5-dimethoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.