CAS 86604-68-4

2-{[(4-methoxy-3-methylpyridin-2-yl)methyl]sulfinyl}-6-(trifluoromethyl)-1H-benzimidazole

Description:

2-{[(4-methoxy-3-methylpyridin-2-yl)methyl]sulfinyl}-6-(trifluoromethyl)-1H-benzimidazole is a chemical compound characterized by its complex structure, which includes a benzimidazole core substituted with a trifluoromethyl group and a sulfinyl moiety linked to a pyridine derivative. The presence of the trifluoromethyl group typically enhances the compound's lipophilicity and may influence its biological activity. The sulfinyl group can impart unique reactivity and stability, while the methoxy and methyl substitutions on the pyridine ring can affect the compound's electronic properties and steric hindrance. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its specific interactions, solubility, and stability would depend on the overall molecular structure and the functional groups present. As with many compounds, its behavior in biological systems would be influenced by its ability to interact with various biological targets, which could be explored further in research contexts.

Formula: C₁₆H₁₄F₃N₃O₂S

InChI: InChI=1/C16H14F3N3O2S/c1-9-13(20-6-5-14(9)24-2)8-25(23)15-21-11-4-3-10(16(17,18)19)7-12(11)22-15/h3-7H,8H2,1-2H3,(H,21,22)

SMILES: Cc1c(CS(=O)c2nc3ccc(cc3[nH]2)C(F)(F)F)nccc1OC