CAS 86604-73-1

5-(trifluoromethyl)-1,3-dihydro-2H-benzimidazole-2-thione

Description:

5-(Trifluoromethyl)-1,3-dihydro-2H-benzimidazole-2-thione is a chemical compound characterized by its unique structural features, including a benzimidazole core and a trifluoromethyl group. This compound typically exhibits properties associated with thiones, such as potential reactivity due to the presence of the sulfur atom in the thione functional group. The trifluoromethyl group enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The presence of the benzimidazole moiety suggests potential applications in pharmaceuticals, as benzimidazoles are known for their diverse biological activities, including antifungal and antiparasitic properties. Additionally, the compound's stability and solubility characteristics may vary depending on the solvent and environmental conditions. Overall, 5-(trifluoromethyl)-1,3-dihydro-2H-benzimidazole-2-thione represents a class of compounds that may have significant implications in various fields, including drug development and agrochemicals.

Formula: C₈H₅F₃N₂S

InChI: InChI=1/C8H5F3N2S/c9-8(10,11)4-1-2-5-6(3-4)13-7(14)12-5/h1-3H,(H2,12,13,14)

SMILES: c1cc2c(cc1C(F)(F)F)[nH]c(n2)S

Synonyms:

• 1H-benzimidazole-2-thiol, 5-(trifluoromethyl)-
• 5-(Trifluoromethyl)-1H-benzimidazole-2-thiol