CAS 86604-79-7
:Pyridine, 2,3,5-trimethyl-4-nitro-, 1-oxide
Description:
Pyridine, 2,3,5-trimethyl-4-nitro-, 1-oxide, commonly referred to as a nitroxide derivative of pyridine, is an organic compound characterized by its pyridine ring substituted with three methyl groups and a nitro group, along with a stable nitroxide functional group. This compound typically exhibits a pale yellow to brown color and is soluble in organic solvents, reflecting its aromatic nature. The presence of the nitro group contributes to its electron-withdrawing properties, which can influence its reactivity and stability. As a nitroxide, it possesses unique radical properties, making it useful in various applications, including as a spin label in electron paramagnetic resonance (EPR) spectroscopy and as an antioxidant in polymer chemistry. The compound's stability and reactivity can be affected by environmental conditions such as temperature and pH. Safety considerations should be taken into account, as nitro compounds can be hazardous and may require proper handling and storage protocols. Overall, this compound is of interest in both synthetic organic chemistry and materials science.
Formula:C8H10N2O3
InChI:InChI=1S/C8H10N2O3/c1-5-4-9(11)7(3)6(2)8(5)10(12)13/h4H,1-3H3
InChI key:InChIKey=YMBLTOGTYNFTRX-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C(C)=C(C)N(=O)=CC1C
Synonyms:- 2,3,5-Trimethyl-4-Nitropyridine-1-Oxide
- 2,3,5-Trimethyl-4-nitro-1-oxidopyridin-1-ium
- 2,3,5-Trimethyl-4-nitropyridine N-oxide
- 4-Nitro-2,3,5-trimethylpyridine-N-oxide
- Pyridine, 2,3,5-trimethyl-4-nitro-, 1-oxide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Nitro-2,3,5-trimethylpyridine N-oxide
CAS:Formula:C8H10N2O3Purity:97%Color and Shape:SolidMolecular weight:182.17662,3,5-Trimethyl-4-Nitropyridine 1-Oxide
CAS:2,3,5-Trimethyl-4-Nitropyridine 1-OxidePurity:97%Molecular weight:182.18g/molOmeprazole Related Compound 5
CAS:Formula:C8H10N2O3Color and Shape:Pale Yellow SolidMolecular weight:182.182,3,5-Trimethyl-4-nitropyridine N-Oxide
CAS:Formula:C8H10N2O3Purity:>98.0%(GC)(T)Color and Shape:White to Orange to Green powder to crystalMolecular weight:182.182,3,5-Trimethyl-4-nitropyridine 1-oxide
CAS:The reaction of 2,3,5-trimethyl-4-nitropyridine 1-oxide with hydrogen peroxide is an example of a peroxide reaction. The HOOH molecule is a nucleophilic and attacks the CNO group. This leads to the formation of a new bond between the oxygen and carbon atoms in the molecule. The oxygen atom then becomes an oxidizing agent, which can react with other molecules in order to form more products. In this reaction, hydrogen peroxide is used as an oxidizing agent to produce chlorine gas, water vapor, and nitric oxide gas. The reaction can be summarized as follows: 2CNO + 3HOOH → 4CO + 2O + 3N2O + 3HO2
Formula:C8H10N2O3Purity:Min. 95%Color and Shape:PowderMolecular weight:182.18 g/mol





