CAS 866040-19-9

3-(1H-Pyrrol-1-yl)-2-benzofurancarboxylic acid 2-(2-furanylcarbonyl)hydrazide

Description:

3-(1H-Pyrrol-1-yl)-2-benzofurancarboxylic acid 2-(2-furanylcarbonyl)hydrazide, identified by its CAS number 866040-19-9, is a chemical compound that features a complex structure incorporating both pyrrole and benzofuran moieties. This compound is characterized by its hydrazide functional group, which is known for its reactivity and potential biological activity. The presence of the pyrrole ring contributes to its aromatic properties, while the benzofuran component enhances its stability and solubility in organic solvents. The carboxylic acid group in the structure may impart acidic characteristics, influencing its interactions in various chemical environments. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its synthesis typically involves multi-step organic reactions, and it may be utilized in research related to drug development or as a building block in organic synthesis. As with many such compounds, its specific applications and behavior would depend on further empirical studies and characterization.

Formula: C₁₈H₁₃N₃O₄

InChI: InChI=1S/C18H13N3O4/c22-17(14-8-5-11-24-14)19-20-18(23)16-15(21-9-3-4-10-21)12-6-1-2-7-13(12)25-16/h1-11H,(H,19,22)(H,20,23)

InChI key: InChIKey=VFXRHDAIELEMHE-UHFFFAOYSA-N

SMILES: C(NNC(=O)C1=CC=CO1)(=O)C2=C(C=3C(O2)=CC=CC3)N4C=CC=C4

Synonyms:

• 3-(1H-Pyrrol-1-yl)-2-benzofurancarboxylic acid 2-(2-furanylcarbonyl)hydrazide
• 2-Benzofurancarboxylic acid, 3-(1H-pyrrol-1-yl)-, 2-(2-furanylcarbonyl)hydrazide