CymitQuimica logo

CAS 866040-66-6

:

Ethyl 5-(3-Nitrophenyl)isoxazole-3-carboxylate

Description:
Ethyl 5-(3-Nitrophenyl)isoxazole-3-carboxylate is a chemical compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. The presence of a nitrophenyl group at the 5-position of the isoxazole contributes to its potential reactivity and biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and may have limited solubility in water, which is common for many isoxazole derivatives. The ethyl ester functional group enhances its lipophilicity, potentially influencing its pharmacokinetic properties. Ethyl 5-(3-Nitrophenyl)isoxazole-3-carboxylate may be of interest in medicinal chemistry for its potential applications in drug development, particularly in the context of anti-inflammatory or anticancer agents, due to the biological activities often associated with nitro-substituted aromatic compounds. As with many organic compounds, safety and handling precautions should be observed, as the nitro group can impart toxicity and environmental concerns.
Formula:C12H10N2O5
InChI:InChI=1S/C12H10N2O5/c1-2-18-12(15)10-7-11(19-13-10)8-4-3-5-9(6-8)14(16)17/h3-7H,2H2,1H3
InChI key:SSOVVOHZUNJEAK-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=NOC(=C1)C2=CC(=CC=C2)[N+](=O)[O-]
Synonyms:
  • Ethyl 5-(3-Nitrophenyl)isoxazole-3-carboxylate
  • 3-Isoxazolecarboxylic acid, 5-(3-nitrophenyl)-, ethyl ester
  • 5-(3-nitrophenyl)-3-Isoxazolecarboxylic acid ethyl ester
Found 4 products.