CymitQuimica logo

CAS 866040-67-7

:

N-(7-Chloro-5H-indeno[5,6-d]-1,3-dioxol-5-yl)-2,2,2-trifluoroacetamide

Description:
N-(7-Chloro-5H-indeno[5,6-d]-1,3-dioxol-5-yl)-2,2,2-trifluoroacetamide is a chemical compound characterized by its unique structure, which includes an indeno-dioxole framework and a trifluoroacetamide functional group. This compound is notable for its potential biological activity, particularly in medicinal chemistry, where it may serve as a lead compound for drug development. The presence of the chloro substituent and the trifluoroacetamide group can influence its solubility, stability, and reactivity, making it an interesting candidate for further study. The indeno-dioxole moiety contributes to its aromatic character, which can affect its interactions with biological targets. Additionally, the trifluoroacetamide group may enhance lipophilicity, potentially improving membrane permeability. As with many synthetic organic compounds, understanding its physicochemical properties, such as melting point, boiling point, and spectral characteristics, is essential for applications in research and industry. Safety data and handling precautions should also be considered due to the presence of halogenated and potentially reactive functional groups.
Formula:C12H7ClF3NO3
InChI:InChI=1S/C12H7ClF3NO3/c13-7-3-8(17-11(18)12(14,15)16)6-2-10-9(1-5(6)7)19-4-20-10/h1-3,8H,4H2,(H,17,18)
InChI key:InChIKey=AASLYRSSMVRFGW-UHFFFAOYSA-N
SMILES:N(C(C(F)(F)F)=O)C1C=2C(=CC3=C(C2)OCO3)C(Cl)=C1
Synonyms:
  • Acetamide, N-(7-chloro-5H-indeno[5,6-d]-1,3-dioxol-5-yl)-2,2,2-trifluoro-
  • N-(7-Chloro-5H-indeno[5,6-d]-1,3-dioxol-5-yl)-2,2,2-trifluoroacetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.