CAS 866040-77-9

β-1-Naphthalenyl-1H-pyrrole-1-propanoic acid

Description:

β-1-Naphthalenyl-1H-pyrrole-1-propanoic acid, identified by its CAS number 866040-77-9, is an organic compound that features a naphthalene moiety fused with a pyrrole ring, along with a propanoic acid functional group. This compound is characterized by its aromatic structure, which contributes to its stability and potential for various chemical interactions. The presence of the propanoic acid group introduces acidity and can influence solubility and reactivity in biological systems. Typically, compounds of this nature may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The naphthalene and pyrrole components suggest potential applications in organic electronics or as intermediates in the synthesis of more complex molecules. Additionally, the compound's structural features may allow for interactions with biological targets, which could be explored in drug development. Overall, β-1-Naphthalenyl-1H-pyrrole-1-propanoic acid represents a unique structure with potential applications in various fields of chemistry and biochemistry.

Formula: C₁₇H₁₅NO₂

InChI: InChI=1S/C17H15NO2/c19-17(20)12-16(18-10-3-4-11-18)15-9-5-7-13-6-1-2-8-14(13)15/h1-11,16H,12H2,(H,19,20)

InChI key: InChIKey=WPHZWPLPYKHTTE-UHFFFAOYSA-N

SMILES: C(CC(O)=O)(C=1C2=C(C=CC1)C=CC=C2)N3C=CC=C3

Synonyms:

• 1H-Pyrrole-1-propanoic acid, β-1-naphthalenyl-
• 3-Naphthalen-1-yl-3-pyrrol-1-yl-propionic acid
• β-1-Naphthalenyl-1H-pyrrole-1-propanoic acid
• 3-Naphthalen-1-yl-3-pyrrol-1-ylpropanoic acid