CymitQuimica logo

CAS 866040-78-0

:

N-[3-[2-(Methylamino)-4-thiazolyl]phenyl]hexanamide

Description:
N-[3-[2-(Methylamino)-4-thiazolyl]phenyl]hexanamide, with the CAS number 866040-78-0, is a chemical compound characterized by its complex structure, which includes a hexanamide backbone and a thiazole moiety. This compound features a phenyl ring substituted with a thiazole group that contains a methylamino functional group, contributing to its potential biological activity. The presence of the thiazole ring suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The hexanamide portion of the molecule indicates that it may exhibit properties typical of amides, such as hydrogen bonding capabilities and moderate solubility in organic solvents. The overall molecular structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions and acylation reactions. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the precise conditions under which it is studied. Further research would be necessary to fully elucidate its properties and potential applications in pharmaceuticals or other fields.
Formula:C16H21N3OS
InChI:InChI=1S/C16H21N3OS/c1-3-4-5-9-15(20)18-13-8-6-7-12(10-13)14-11-21-16(17-2)19-14/h6-8,10-11H,3-5,9H2,1-2H3,(H,17,19)(H,18,20)
InChI key:InChIKey=AZKUFSUJWOYBQN-UHFFFAOYSA-N
SMILES:N(C(CCCCC)=O)C=1C=C(C=CC1)C=2N=C(NC)SC2
Synonyms:
  • N-[3-[2-(Methylamino)-4-thiazolyl]phenyl]hexanamide
  • Hexanamide, N-[3-[2-(methylamino)-4-thiazolyl]phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.