CAS 866042-10-6

Ethyl 2-[[5-[[(phenylamino)carbonyl]amino]-1,3,4-thiadiazol-2-yl]thio]acetate

Description:

Ethyl 2-[[5-[[(phenylamino)carbonyl]amino]-1,3,4-thiadiazol-2-yl]thio]acetate, identified by its CAS number 866042-10-6, is a chemical compound characterized by its complex structure, which includes an ethyl ester group, a thiadiazole ring, and a phenylamino substituent. This compound typically exhibits properties associated with both organic and heterocyclic chemistry, including potential biological activity due to the presence of the thiadiazole moiety, which is known for its diverse pharmacological properties. The presence of the phenylamino group may contribute to its ability to interact with biological targets, making it of interest in medicinal chemistry. Additionally, the ethyl acetate portion suggests that it may be soluble in organic solvents, which is a common characteristic of esters. The compound's synthesis and reactivity can be influenced by the functional groups present, allowing for potential applications in drug development or as a chemical intermediate. Overall, this compound represents a unique combination of structural features that may confer specific chemical and biological properties.

Formula: C₁₃H₁₄N₄O₃S₂

InChI: InChI=1S/C13H14N4O3S2/c1-2-20-10(18)8-21-13-17-16-12(22-13)15-11(19)14-9-6-4-3-5-7-9/h3-7H,2,8H2,1H3,(H2,14,15,16,19)

InChI key: InChIKey=FIECLVSDPSGDDY-UHFFFAOYSA-N

SMILES: N(C(NC1=CC=CC=C1)=O)C=2SC(SCC(OCC)=O)=NN2

Synonyms:

• Ethyl 2-[[5-[[(phenylamino)carbonyl]amino]-1,3,4-thiadiazol-2-yl]thio]acetate
• Acetic acid, [[5-[[(phenylamino)carbonyl]amino]-1,3,4-thiadiazol-2-yl]thio]-, ethyl ester
• Acetic acid, 2-[[5-[[(phenylamino)carbonyl]amino]-1,3,4-thiadiazol-2-yl]thio]-, ethyl ester