CAS 866042-21-9

Ethyl 2-(2-pyrazinylthio)propanoate

Description:

Ethyl 2-(2-pyrazinylthio)propanoate, identified by its CAS number 866042-21-9, is an organic compound characterized by its ester functional group and the presence of a pyrazine ring. This compound features a propanoate backbone, which contributes to its reactivity and potential applications in organic synthesis. The pyrazinylthio moiety introduces unique electronic and steric properties, making it of interest in medicinal chemistry and material science. Ethyl 2-(2-pyrazinylthio)propanoate is likely to exhibit moderate solubility in organic solvents, while its stability can be influenced by environmental factors such as temperature and pH. The compound may participate in various chemical reactions, including nucleophilic substitutions and esterifications, due to the presence of both the ester and thioether functionalities. Its potential biological activity, particularly in relation to pyrazine derivatives, could be explored for pharmaceutical applications. However, specific safety and handling guidelines should be followed, as with all chemical substances, to ensure safe laboratory practices.

Formula: C₉H₁₂N₂O₂S

InChI: InChI=1S/C9H12N2O2S/c1-3-13-9(12)7(2)14-8-6-10-4-5-11-8/h4-7H,3H2,1-2H3

InChI key: InChIKey=WIZNUAZBKWKOSS-UHFFFAOYSA-N

SMILES: S(C(C(OCC)=O)C)C=1C=NC=CN1

Synonyms:

• Ethyl 2-(2-pyrazinylthio)propanoate
• Propanoic acid, 2-(pyrazinylthio)-, ethyl ester
• Propanoic acid, 2-(2-pyrazinylthio)-, ethyl ester