CAS 866042-42-4
:N-(3,4-Dihydro-2H-pyrrol-5-yl)-1,1,1-trifluoromethanesulfonamide
Description:
N-(3,4-Dihydro-2H-pyrrol-5-yl)-1,1,1-trifluoromethanesulfonamide is a chemical compound characterized by its unique structural features, including a pyrrolidine ring and a trifluoromethanesulfonamide functional group. This compound typically exhibits properties associated with sulfonamides, such as potential antimicrobial activity, and the presence of trifluoromethyl groups can enhance lipophilicity and metabolic stability. The molecular structure suggests it may participate in hydrogen bonding due to the sulfonamide moiety, which can influence its solubility and reactivity. Additionally, the trifluoromethyl group is known to impart unique electronic properties, potentially affecting the compound's biological activity. The compound's CAS number, 866042-42-4, allows for easy identification in chemical databases, facilitating research and development in pharmaceutical applications. Overall, this compound's characteristics make it of interest in medicinal chemistry, particularly in the design of new therapeutic agents.
Formula:C5H7F3N2O2S
InChI:InChI=1S/C5H7F3N2O2S/c6-5(7,8)13(11,12)10-4-2-1-3-9-4/h1-3H2,(H,9,10)
InChI key:InChIKey=GUBGYQGFKAIVFX-UHFFFAOYSA-N
SMILES:N(S(C(F)(F)F)(=O)=O)C=1CCCN1
Synonyms:- N-(3,4-Dihydro-2H-pyrrol-5-yl)-1,1,1-trifluoromethanesulfonamide
- Methanesulfonamide, N-(3,4-dihydro-2H-pyrrol-5-yl)-1,1,1-trifluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.