CAS 866042-48-0

2-Chloro-N-(2,3-dihydro-2,2,4-trimethyl-7-benzofuranyl)benzenesulfonamide

Description:

2-Chloro-N-(2,3-dihydro-2,2,4-trimethyl-7-benzofuranyl)benzenesulfonamide is a chemical compound characterized by its complex structure, which includes a chloro group, a sulfonamide functional group, and a benzofuran moiety. The presence of the chloro substituent indicates potential reactivity, while the sulfonamide group suggests properties typical of sulfonamides, such as antibacterial activity. The compound's benzofuran structure contributes to its aromatic characteristics and may influence its solubility and interaction with biological systems. Additionally, the presence of multiple methyl groups in the trimethyl portion of the molecule can enhance lipophilicity, potentially affecting its pharmacokinetics. This compound may be of interest in medicinal chemistry for its potential therapeutic applications, particularly in the development of new drugs. However, specific biological activity, toxicity, and environmental impact would require further investigation through experimental studies. As with many chemical substances, safety data and handling precautions should be adhered to, given the presence of chlorine and sulfonamide functionalities.

Formula: C₁₇H₁₈ClNO₃S

InChI: InChI=1S/C17H18ClNO3S/c1-11-8-9-14(16-12(11)10-17(2,3)22-16)19-23(20,21)15-7-5-4-6-13(15)18/h4-9,19H,10H2,1-3H3

InChI key: InChIKey=QZPHHVQHIHSOTN-UHFFFAOYSA-N

SMILES: N(S(=O)(=O)C1=C(Cl)C=CC=C1)C2=C3C(CC(C)(C)O3)=C(C)C=C2

Synonyms:

• Benzenesulfonamide, 2-chloro-N-(2,3-dihydro-2,2,4-trimethyl-7-benzofuranyl)-
• 2-Chloro-N-(2,3-dihydro-2,2,4-trimethyl-7-benzofuranyl)benzenesulfonamide