CAS 866042-80-0
:1-(4-Methylbenzoyl)-3-azetidinecarboxylic acid
Description:
1-(4-Methylbenzoyl)-3-azetidinecarboxylic acid is a chemical compound characterized by its unique structure, which includes an azetidine ring and a benzoyl moiety. The presence of the 4-methylbenzoyl group contributes to its aromatic properties, while the azetidine ring introduces a cyclic amine structure, which can influence its reactivity and biological activity. This compound is likely to exhibit both acidic and basic characteristics due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, such as esterification or amidation. Additionally, the steric effects of the methyl group on the benzoyl ring may affect its interactions with other molecules, potentially influencing its pharmacological properties. The compound's solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. Overall, 1-(4-Methylbenzoyl)-3-azetidinecarboxylic acid is of interest in medicinal chemistry and may have applications in drug development or as a synthetic intermediate in organic synthesis.
Formula:C12H13NO3
InChI:InChI=1S/C12H13NO3/c1-8-2-4-9(5-3-8)11(14)13-6-10(7-13)12(15)16/h2-5,10H,6-7H2,1H3,(H,15,16)
InChI key:InChIKey=ILIKRFYAMVZWMT-UHFFFAOYSA-N
SMILES:C(=O)(N1CC(C(O)=O)C1)C2=CC=C(C)C=C2
Synonyms:- 1-(4-Methylbenzoyl)-3-azetidinecarboxylic acid
- 3-Azetidinecarboxylic acid, 1-(4-methylbenzoyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.