CymitQuimica logo

CAS 866043-53-0

:

3,3′-(Methylimino)methylenebis[N-(2,6-dimethylphenyl)urea]

Description:
3,3′-(Methylimino)methylenebis[N-(2,6-dimethylphenyl)urea], with the CAS number 866043-53-0, is a chemical compound that belongs to the class of ureas. It features a central methylimino group linked to two N-(2,6-dimethylphenyl)urea moieties, which contributes to its unique structural and functional properties. This compound is characterized by its potential applications in various fields, including agriculture as a herbicide or fungicide, due to its ability to inhibit specific biological processes in target organisms. The presence of the dimethylphenyl groups enhances its lipophilicity, which can influence its bioavailability and interaction with biological systems. Additionally, the compound may exhibit specific solubility characteristics, stability under various conditions, and reactivity profiles that are important for its practical applications. Safety and handling considerations are essential, as with any chemical substance, to mitigate risks associated with exposure. Overall, 3,3′-(Methylimino)methylenebis[N-(2,6-dimethylphenyl)urea] represents a complex organic molecule with significant potential in chemical applications.
Formula:C20H25N5O2
InChI:InChI=1S/C20H25N5O2/c1-12-8-6-9-13(2)16(12)22-19(26)24-18(21-5)25-20(27)23-17-14(3)10-7-11-15(17)4/h6-11H,1-5H3,(H4,21,22,23,24,25,26,27)
InChI key:InChIKey=GKIUUVWTTVWLII-UHFFFAOYSA-N
SMILES:N(C(NC(NC(NC1=C(C)C=CC=C1C)=O)=NC)=O)C2=C(C)C=CC=C2C
Synonyms:
  • N′-[[[(2,6-Dimethylanilino)carbonyl]amino](methylamino)methylidene]-N-(2,6-dimethylphenyl)urea
  • Urea, 3,3′-(methylimino)methylenebis[N-(2,6-dimethylphenyl)-
  • n′-((e)-(((2,6-Dimethylanilino)carbonyl)amino)(methylamino)methylidene)-n-(2,6-dimethylphenyl)urea
  • 3,3′-(Methylimino)methylenebis[N-(2,6-dimethylphenyl)urea]
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.