
CAS 866049-12-9
:4-[(4-Methylphenyl)thio]-2-(methylthio)thieno[3,2-d]pyrimidine
Description:
4-[(4-Methylphenyl)thio]-2-(methylthio)thieno[3,2-d]pyrimidine is a heterocyclic compound characterized by its complex structure, which includes a thieno[3,2-d]pyrimidine core. This compound features a thioether functional group, indicated by the presence of sulfur atoms in its structure, contributing to its chemical reactivity and potential biological activity. The presence of the 4-methylphenyl and methylthio substituents enhances its lipophilicity, which may influence its solubility and permeability in biological systems. Such compounds are often investigated for their pharmacological properties, including potential roles as kinase inhibitors or in other therapeutic applications. The molecular structure suggests that it may exhibit interesting electronic properties due to the conjugation within the heterocyclic ring system. Additionally, the compound's stability, reactivity, and interactions with biological targets can be influenced by the arrangement of its substituents, making it a subject of interest in medicinal chemistry and drug design.
Formula:C14H12N2S3
InChI:InChI=1S/C14H12N2S3/c1-9-3-5-10(6-4-9)19-13-12-11(7-8-18-12)15-14(16-13)17-2/h3-8H,1-2H3
InChI key:InChIKey=OJGSZQMSEJMLKK-UHFFFAOYSA-N
SMILES:S(C1=C2C(=NC(SC)=N1)C=CS2)C3=CC=C(C)C=C3
Synonyms:- 4-[(4-Methylphenyl)thio]-2-(methylthio)thieno[3,2-d]pyrimidine
- Thieno[3,2-d]pyrimidine, 4-[(4-methylphenyl)thio]-2-(methylthio)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.