CAS 866049-60-7
:1-(3-Methoxyphenyl)-3-[2-(methylthio)-3-quinolinyl]-2-propen-1-one
Description:
1-(3-Methoxyphenyl)-3-[2-(methylthio)-3-quinolinyl]-2-propen-1-one, with the CAS number 866049-60-7, is an organic compound characterized by its unique structure, which includes a propenone backbone substituted with a methoxyphenyl group and a methylthio-quinolinyl moiety. This compound typically exhibits properties associated with both aromatic and alkenyl systems, contributing to its potential biological activity. The presence of the methoxy group can enhance lipophilicity and influence the compound's interaction with biological targets. Additionally, the quinoline ring is known for its diverse pharmacological properties, including antimicrobial and anticancer activities. The methylthio group may also play a role in modulating the compound's reactivity and biological effects. Overall, this compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. However, specific physical and chemical properties such as solubility, melting point, and spectral characteristics would require empirical determination or literature reference for precise values.
Formula:C20H17NO2S
InChI:InChI=1S/C20H17NO2S/c1-23-17-8-5-7-15(13-17)19(22)11-10-16-12-14-6-3-4-9-18(14)21-20(16)24-2/h3-13H,1-2H3
InChI key:InChIKey=SMDYLRBEFBDDRN-UHFFFAOYSA-N
SMILES:C(=CC(=O)C1=CC(OC)=CC=C1)C2=CC3=C(N=C2SC)C=CC=C3
Synonyms:- 2-Propen-1-one, 1-(3-methoxyphenyl)-3-[2-(methylthio)-3-quinolinyl]-
- 1-(3-Methoxyphenyl)-3-[2-(methylthio)-3-quinolinyl]-2-propen-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.