CAS 866050-02-4

3-[[1-(4-Methylphenyl)-3-(3,4,5-trimethoxyphenyl)-2-propen-1-ylidene]amino]-2-butenenitrile

Description:

3-[[1-(4-Methylphenyl)-3-(3,4,5-trimethoxyphenyl)-2-propen-1-ylidene]amino]-2-butenenitrile, identified by its CAS number 866050-02-4, is a synthetic organic compound characterized by its complex structure, which includes multiple aromatic rings and functional groups. This compound features a butenenitrile moiety, which contributes to its reactivity and potential applications in organic synthesis. The presence of methoxy groups enhances its solubility and may influence its electronic properties, making it of interest in various chemical and pharmaceutical contexts. The compound's structure suggests potential biological activity, possibly as a ligand or in medicinal chemistry, although specific biological properties would require empirical investigation. Its synthesis typically involves multi-step organic reactions, highlighting its complexity. As with many organic compounds, safety data, including toxicity and handling precautions, should be consulted before use in laboratory or industrial settings. Overall, this compound exemplifies the intricate nature of organic chemistry and the potential for novel applications in research and development.

Formula: C₂₃H₂₄N₂O₃

InChI: InChI=1S/C23H24N2O3/c1-16-6-9-19(10-7-16)20(25-17(2)12-13-24)11-8-18-14-21(26-3)23(28-5)22(15-18)27-4/h6-12,14-15H,1-5H3

InChI key: InChIKey=ODMSIAXFUIPLQT-UHFFFAOYSA-N

SMILES: O(C)C1=C(OC)C=C(C=CC(=NC(=CC#N)C)C2=CC=C(C)C=C2)C=C1OC

Synonyms:

• 3-[[1-(4-Methylphenyl)-3-(3,4,5-trimethoxyphenyl)-2-propen-1-ylidene]amino]-2-butenenitrile
• 2-Butenenitrile, 3-[[1-(4-methylphenyl)-3-(3,4,5-trimethoxyphenyl)-2-propen-1-ylidene]amino]-
• 2-Butenenitrile, 3-[[1-(4-methylphenyl)-3-(3,4,5-trimethoxyphenyl)-2-propenylidene]amino]-