CAS 866050-31-9
:4-(2,3-Dihydro-1H-inden-5-yl)-2-pyrimidinamine
Description:
4-(2,3-Dihydro-1H-inden-5-yl)-2-pyrimidinamine, identified by its CAS number 866050-31-9, is a chemical compound characterized by its unique structure that combines a pyrimidine ring with a dihydroindene moiety. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, including potential biological activity due to its nitrogen-containing heterocycles. It may be soluble in organic solvents, and its solubility can vary based on the presence of functional groups and the overall molecular structure. The compound's molecular framework suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its synthesis may involve standard organic reactions, including amination and cyclization processes. As with many organic compounds, its stability, reactivity, and interactions with other substances would depend on environmental conditions such as pH, temperature, and the presence of catalysts or other reagents. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.
Formula:C13H13N3
InChI:InChI=1S/C13H13N3/c14-13-15-7-6-12(16-13)11-5-4-9-2-1-3-10(9)8-11/h4-8H,1-3H2,(H2,14,15,16)
InChI key:InChIKey=YXWFHCAJVDEHQN-UHFFFAOYSA-N
SMILES:NC=1N=C(C=2C=C3C(=CC2)CCC3)C=CN1
Synonyms:- 4-(2,3-Dihydro-1H-inden-5-yl)-2-pyrimidinamine
- 2-Pyrimidinamine, 4-(2,3-dihydro-1H-inden-5-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-(2,3-Dihydro-1H-inden-5-yl)pyrimidin-2-amine
CAS:4-(2,3-Dihydro-1H-inden-5-yl)pyrimidin-2-aminePurity:techMolecular weight:211.26g/mol
