
CAS 866050-32-0
:5-(2,3-Dihydro-1H-inden-5-yl)-2-(methylthio)[1,2,4]triazolo[1,5-a]pyrimidine
Description:
5-(2,3-Dihydro-1H-inden-5-yl)-2-(methylthio)[1,2,4]triazolo[1,5-a]pyrimidine is a chemical compound characterized by its unique structural features, which include a triazolo-pyrimidine core and a dihydroindene moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, which may include anti-inflammatory or anti-cancer effects, although specific biological data would depend on empirical studies. The presence of the methylthio group suggests potential for increased lipophilicity, which can influence its pharmacokinetic properties. The compound's molecular structure may allow for interactions with various biological targets, making it of interest in medicinal chemistry. Additionally, its synthesis may involve multi-step organic reactions, highlighting its complexity. As with many synthetic organic compounds, stability, solubility, and reactivity can vary based on environmental conditions and the presence of other substances. Overall, this compound represents a class of molecules that could be explored for therapeutic applications, pending further research and validation.
Formula:C15H14N4S
InChI:InChI=1S/C15H14N4S/c1-20-15-17-14-16-13(7-8-19(14)18-15)12-6-5-10-3-2-4-11(10)9-12/h5-9H,2-4H2,1H3
InChI key:InChIKey=YYGWONONLDTYGX-UHFFFAOYSA-N
SMILES:S(C)C=1N=C2N(N1)C=CC(=N2)C=3C=C4C(=CC3)CCC4
Synonyms:- 5-(2,3-Dihydro-1H-inden-5-yl)-2-(methylthio)[1,2,4]triazolo[1,5-a]pyrimidine
- [1,2,4]Triazolo[1,5-a]pyrimidine, 5-(2,3-dihydro-1H-inden-5-yl)-2-(methylthio)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.