CAS 866050-79-5

3-[4-[(2-Chloro-5-thiazolyl)methoxy]-3-methoxyphenyl]-2-propenoic acid

Description:

3-[4-[(2-Chloro-5-thiazolyl)methoxy]-3-methoxyphenyl]-2-propenoic acid, identified by its CAS number 866050-79-5, is a synthetic organic compound characterized by its complex molecular structure, which includes a propenoic acid moiety and a thiazole ring. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the thiazole group suggests possible interactions with biological targets, making it of interest in medicinal chemistry. Its methoxy substituents enhance lipophilicity, potentially influencing its solubility and permeability in biological systems. The chlorine atom in the thiazole ring may also play a role in modulating the compound's reactivity and biological interactions. Overall, this compound's unique structural features may confer specific pharmacological properties, warranting further investigation for applications in drug development or other chemical applications.

Formula: C₁₄H₁₂ClNO₄S

InChI: InChI=1S/C14H12ClNO4S/c1-19-12-6-9(3-5-13(17)18)2-4-11(12)20-8-10-7-16-14(15)21-10/h2-7H,8H2,1H3,(H,17,18)

InChI key: InChIKey=ZPKQOZGAPCPKMD-UHFFFAOYSA-N

SMILES: O(CC1=CN=C(Cl)S1)C2=C(OC)C=C(C=CC(O)=O)C=C2

Synonyms:

• 2-Propenoic acid, 3-[4-[(2-chloro-5-thiazolyl)methoxy]-3-methoxyphenyl]-
• 3-[4-[(2-Chloro-5-thiazolyl)methoxy]-3-methoxyphenyl]-2-propenoic acid