
CAS 866050-81-9
:2-(4-Fluorophenyl)-7-methyl-5-(1-piperidinyl)imidazo[1,2-a]pyrimidine
Description:
2-(4-Fluorophenyl)-7-methyl-5-(1-piperidinyl)imidazo[1,2-a]pyrimidine, with the CAS number 866050-81-9, is a synthetic organic compound characterized by its complex heterocyclic structure. This compound features an imidazo[1,2-a]pyrimidine core, which is a bicyclic structure containing both nitrogen and carbon atoms, contributing to its potential biological activity. The presence of a 4-fluorophenyl group enhances its lipophilicity and may influence its interaction with biological targets. Additionally, the 1-piperidinyl substituent provides a basic nitrogen atom, which can participate in hydrogen bonding and may enhance the compound's pharmacological properties. This compound is of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential as a kinase inhibitor or in other therapeutic applications. Its unique structural features suggest that it may exhibit specific interactions with biological macromolecules, making it a candidate for further research in drug discovery and development.
Formula:C18H19FN4
InChI:InChI=1S/C18H19FN4/c1-13-11-17(22-9-3-2-4-10-22)23-12-16(21-18(23)20-13)14-5-7-15(19)8-6-14/h5-8,11-12H,2-4,9-10H2,1H3
InChI key:InChIKey=ODXIBXDKDHHSNW-UHFFFAOYSA-N
SMILES:CC=1C=C(N2C(=NC(=C2)C3=CC=C(F)C=C3)N1)N4CCCCC4
Synonyms:- 2-(4-Fluorophenyl)-7-methyl-5-(1-piperidinyl)imidazo[1,2-a]pyrimidine
- Imidazo[1,2-a]pyrimidine, 2-(4-fluorophenyl)-7-methyl-5-(1-piperidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.