CymitQuimica logo

CAS 866084-31-3

:

tert-butyl 4-(6-(8-cyclopentyl-5-Methyl-7-oxo-6-(1-propoxyvinyl)-7,8-dihydropyrido[2,3-d]pyrimidin-2-ylamino)pyridin-3-yl)piperazine-1-carboxylate

Description:
Tert-butyl 4-(6-(8-cyclopentyl-5-methyl-7-oxo-6-(1-propoxyvinyl)-7,8-dihydropyrido[2,3-d]pyrimidin-2-ylamino)pyridin-3-yl)piperazine-1-carboxylate, with CAS number 866084-31-3, is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as piperazine, pyridine, and pyrimidine derivatives. This compound is likely to exhibit properties typical of heterocyclic compounds, including potential biological activity due to its structural motifs that may interact with biological targets. The presence of a tert-butyl group suggests increased lipophilicity, which can influence its solubility and permeability in biological systems. Additionally, the cyclopentyl and propoxyvinyl groups may contribute to its pharmacokinetic properties. Given its complexity, this substance may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. However, detailed studies would be necessary to elucidate its specific characteristics, including its stability, reactivity, and biological activity.
Formula:C33H45N7O4
InChI:InChI=1S/C33H45N7O4/c1-7-8-19-43-23(3)28-22(2)26-21-35-31(37-29(26)40(30(28)41)24-11-9-10-12-24)36-27-14-13-25(20-34-27)38-15-17-39(18-16-38)32(42)44-33(4,5)6/h13-14,20-21,24H,3,7-12,15-19H2,1-2,4-6H3,(H,34,35,36,37)
InChI key:SCWKOLRZBMGTNT-UHFFFAOYSA-N
SMILES:CCCCOC(=C)C1=C(C2=CN=C(N=C2N(C1=O)C3CCCC3)NC4=NC=C(C=C4)N5CCN(CC5)C(=O)OC(C)(C)C)C
Found 6 products.