CymitQuimica logo

CAS 866131-16-0

:

7-(Methylthio)-2-phenylpyrimido[4,5-d]pyrimidin-4(3H)-one

Description:
7-(Methylthio)-2-phenylpyrimido[4,5-d]pyrimidin-4(3H)-one is a heterocyclic compound characterized by its complex fused ring structure, which includes both pyrimidine and pyrimidinone moieties. This compound features a methylthio group, which can influence its chemical reactivity and solubility properties. The presence of the phenyl group contributes to its aromatic characteristics, potentially enhancing its stability and interaction with biological targets. The compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its unique structure allows for potential interactions with enzymes or receptors, which could lead to therapeutic applications. Additionally, the compound's solubility and stability in different solvents can vary, impacting its formulation and use in research. Overall, 7-(Methylthio)-2-phenylpyrimido[4,5-d]pyrimidin-4(3H)-one represents a class of compounds that may hold promise in pharmacological studies, although specific biological activities and mechanisms would require further investigation.
Formula:C13H10N4OS
InChI:InChI=1S/C13H10N4OS/c1-19-13-14-7-9-11(17-13)15-10(16-12(9)18)8-5-3-2-4-6-8/h2-7H,1H3,(H,14,15,16,17,18)
InChI key:InChIKey=FHXIUJIPJZYUEC-UHFFFAOYSA-N
SMILES:O=C1C=2C(=NC(=N1)C3=CC=CC=C3)NC(SC)=NC2
Synonyms:
  • 7-(Methylthio)-2-phenylpyrimido[4,5-d]pyrimidin-4(3H)-one
  • Pyrimido[4,5-d]pyrimidin-4(3H)-one, 7-(methylthio)-2-phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.