CymitQuimica logo

CAS 866131-57-9

:

5-[[1-[(2-Chloro-5-thiazolyl)methyl]-1H-pyrrol-2-yl]methylene]-2,4,6(1H,3H,5H)-pyrimidinetrione

Description:
The chemical substance known as 5-[[1-[(2-Chloro-5-thiazolyl)methyl]-1H-pyrrol-2-yl]methylene]-2,4,6(1H,3H,5H)-pyrimidinetrione, with the CAS number 866131-57-9, is a complex organic compound characterized by its unique structural features. It contains a pyrimidinetrione core, which is a bicyclic structure featuring three carbonyl groups, contributing to its potential biological activity. The presence of a thiazole ring and a pyrrole moiety indicates that this compound may exhibit interesting pharmacological properties, possibly related to its interactions with biological targets. The chlorine substituent on the thiazole ring can enhance lipophilicity and influence the compound's reactivity and binding affinity. This compound is likely to be of interest in medicinal chemistry, particularly for its potential applications in drug development. Its synthesis and characterization would involve standard organic chemistry techniques, and its properties could be further explored through various analytical methods, including NMR, mass spectrometry, and crystallography, to elucidate its behavior in biological systems.
Formula:C13H9ClN4O3S
InChI:InChI=1S/C13H9ClN4O3S/c14-12-15-5-8(22-12)6-18-3-1-2-7(18)4-9-10(19)16-13(21)17-11(9)20/h1-5H,6H2,(H2,16,17,19,20,21)
InChI key:InChIKey=MEYJTSSJWFAIPU-UHFFFAOYSA-N
SMILES:C(N1C(C=C2C(=O)NC(=O)NC2=O)=CC=C1)C3=CN=C(Cl)S3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.